About 3-hydroxy-2-(1,2,4-triazol-4-yl)propanoic acid
3-hydroxy-2-(1,2,4-triazol-4-yl)propanoic acid (PubChem CID 66166842) has the molecular formula C5H7N3O3
and a molecular weight of 157.13 g/mol. Its IUPAC name is 3-hydroxy-2-(1,2,4-triazol-4-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-hydroxy-2-(1,2,4-triazol-4-yl)propanoic acid |
| PubChem CID | 66166842 |
| Molecular Formula | C5H7N3O3 |
| Molecular Weight | 157.13 g/mol |
| Exact Mass | 157.05 |
| IUPAC Name | 3-hydroxy-2-(1,2,4-triazol-4-yl)propanoic acid |
| SMILES | O=C(O)C(CO)n1cnnc1 |
| InChI | InChI=1S/C5H7N3O3/c9-1-4(5(10)11)8-2-6-7-3-8/h2-4,9H,1H2,(H,10,11) |
| InChIKey | PXDKSOGABSSGSG-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.13 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-hydroxy-2-(1,2,4-triazol-4-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-2-(1,2,4-triazol-4-yl)propanoic acid?
The IUPAC name of 3-hydroxy-2-(1,2,4-triazol-4-yl)propanoic acid (CID 66166842) is 3-hydroxy-2-(1,2,4-triazol-4-yl)propanoic acid.
What is the SMILES notation for 3-hydroxy-2-(1,2,4-triazol-4-yl)propanoic acid?
The canonical SMILES for 3-hydroxy-2-(1,2,4-triazol-4-yl)propanoic acid is O=C(O)C(CO)n1cnnc1.
What is the InChIKey of 3-hydroxy-2-(1,2,4-triazol-4-yl)propanoic acid?
The InChIKey is PXDKSOGABSSGSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O3/c9-1-4(5(10)11)8-2-6-7-3-8/h2-4,9H,1H2,(H,10,11).
What are the key properties of 3-hydroxy-2-(1,2,4-triazol-4-yl)propanoic acid?
3-hydroxy-2-(1,2,4-triazol-4-yl)propanoic acid has a molecular weight of 157.13 g/mol, XLogP of -1.10, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2-(1,2,4-triazol-4-yl)propanoic acid is sourced from PubChem (CID 66166842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).