About 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]-2-hydroxypropanoic acid
3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]-2-hydroxypropanoic acid (PubChem CID 66167300) has the molecular formula C7H9N3O7S
and a molecular weight of 279.23 g/mol. Its IUPAC name is 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]-2-hydroxypropanoic acid.
Molecular Properties
| Compound Name | 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]-2-hydroxypropanoic acid |
| PubChem CID | 66167300 |
| Molecular Formula | C7H9N3O7S |
| Molecular Weight | 279.23 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]-2-hydroxypropanoic acid |
| SMILES | O=C(O)C(O)CNS(=O)(=O)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C7H9N3O7S/c11-3(6(13)14)1-9-18(16,17)4-2-8-7(15)10-5(4)12/h2-3,9,11H,1H2,(H,13,14)(H2,8,10,12,15) |
| InChIKey | DQCZOJOLVPHAAU-UHFFFAOYSA-N |
| XLogP | -3.21 |
| TPSA | 169.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.23 |
| LogP ≤ 5 | -3.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]-2-hydroxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]-2-hydroxypropanoic acid?
The IUPAC name of 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]-2-hydroxypropanoic acid (CID 66167300) is 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]-2-hydroxypropanoic acid.
What is the SMILES notation for 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]-2-hydroxypropanoic acid?
The canonical SMILES for 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]-2-hydroxypropanoic acid is O=C(O)C(O)CNS(=O)(=O)c1c[nH]c(=O)[nH]c1=O.
What is the InChIKey of 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]-2-hydroxypropanoic acid?
The InChIKey is DQCZOJOLVPHAAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O7S/c11-3(6(13)14)1-9-18(16,17)4-2-8-7(15)10-5(4)12/h2-3,9,11H,1H2,(H,13,14)(H2,8,10,12,15).
What are the key properties of 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]-2-hydroxypropanoic acid?
3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]-2-hydroxypropanoic acid has a molecular weight of 279.23 g/mol, XLogP of -3.21, 5 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]-2-hydroxypropanoic acid is sourced from PubChem (CID 66167300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).