C10H19N3O5 — CID 66167409
2-hydroxy-3-[[[2-(methylamino)-2-oxoethyl]-propylcarbamoyl]amino]propanoic acid (PubChem CID 66167409) has the molecular formula C10H19N3O5 and a molecular weight of 261.28 g/mol. Its IUPAC name is 2-hydroxy-3-[[[2-(methylamino)-2-oxoethyl]-propylcarbamoyl]amino]propanoic acid.
| Compound Name | 2-hydroxy-3-[[[2-(methylamino)-2-oxoethyl]-propylcarbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 66167409 |
| Molecular Formula | C10H19N3O5 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 2-hydroxy-3-[[[2-(methylamino)-2-oxoethyl]-propylcarbamoyl]amino]propanoic acid |
| SMILES | CCCN(CC(=O)NC)C(=O)NCC(O)C(=O)O |
| InChI | InChI=1S/C10H19N3O5/c1-3-4-13(6-8(15)11-2)10(18)12-5-7(14)9(16)17/h7,14H,3-6H2,1-2H3,(H,11,15)(H,12,18)(H,16,17) |
| InChIKey | BGONDYPWSMYHOJ-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |