About 4,6-dibromo-2-(4-methoxyphenyl)-1,3-benzoxazol-5-amine
4,6-dibromo-2-(4-methoxyphenyl)-1,3-benzoxazol-5-amine (PubChem CID 661675) has the molecular formula C14H10Br2N2O2
and a molecular weight of 398.05 g/mol. Its IUPAC name is 4,6-dibromo-2-(4-methoxyphenyl)-1,3-benzoxazol-5-amine.
Molecular Properties
| Compound Name | 4,6-dibromo-2-(4-methoxyphenyl)-1,3-benzoxazol-5-amine |
| PubChem CID | 661675 |
| Molecular Formula | C14H10Br2N2O2 |
| Molecular Weight | 398.05 g/mol |
| Exact Mass | 395.91 |
| IUPAC Name | 4,6-dibromo-2-(4-methoxyphenyl)-1,3-benzoxazol-5-amine |
| SMILES | COc1ccc(-c2nc3c(Br)c(N)c(Br)cc3o2)cc1 |
| InChI | InChI=1S/C14H10Br2N2O2/c1-19-8-4-2-7(3-5-8)14-18-13-10(20-14)6-9(15)12(17)11(13)16/h2-6H,17H2,1H3 |
| InChIKey | CKKBMXQJCGCPOW-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.05 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4,6-dibromo-2-(4-methoxyphenyl)-1,3-benzoxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dibromo-2-(4-methoxyphenyl)-1,3-benzoxazol-5-amine?
The IUPAC name of 4,6-dibromo-2-(4-methoxyphenyl)-1,3-benzoxazol-5-amine (CID 661675) is 4,6-dibromo-2-(4-methoxyphenyl)-1,3-benzoxazol-5-amine.
What is the SMILES notation for 4,6-dibromo-2-(4-methoxyphenyl)-1,3-benzoxazol-5-amine?
The canonical SMILES for 4,6-dibromo-2-(4-methoxyphenyl)-1,3-benzoxazol-5-amine is COc1ccc(-c2nc3c(Br)c(N)c(Br)cc3o2)cc1.
What is the InChIKey of 4,6-dibromo-2-(4-methoxyphenyl)-1,3-benzoxazol-5-amine?
The InChIKey is CKKBMXQJCGCPOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Br2N2O2/c1-19-8-4-2-7(3-5-8)14-18-13-10(20-14)6-9(15)12(17)11(13)16/h2-6H,17H2,1H3.
What are the key properties of 4,6-dibromo-2-(4-methoxyphenyl)-1,3-benzoxazol-5-amine?
4,6-dibromo-2-(4-methoxyphenyl)-1,3-benzoxazol-5-amine has a molecular weight of 398.05 g/mol, XLogP of 4.61, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dibromo-2-(4-methoxyphenyl)-1,3-benzoxazol-5-amine is sourced from PubChem (CID 661675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).