C12H12N2O4S — CID 66168126
2-hydroxy-3-[(3-pyrrol-1-ylthiophene-2-carbonyl)amino]propanoic acid (PubChem CID 66168126) has the molecular formula C12H12N2O4S and a molecular weight of 280.31 g/mol. Its IUPAC name is 2-hydroxy-3-[(3-pyrrol-1-ylthiophene-2-carbonyl)amino]propanoic acid.
| Compound Name | 2-hydroxy-3-[(3-pyrrol-1-ylthiophene-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 66168126 |
| Molecular Formula | C12H12N2O4S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 2-hydroxy-3-[(3-pyrrol-1-ylthiophene-2-carbonyl)amino]propanoic acid |
| SMILES | O=C(NCC(O)C(=O)O)c1sccc1-n1cccc1 |
| InChI | InChI=1S/C12H12N2O4S/c15-9(12(17)18)7-13-11(16)10-8(3-6-19-10)14-4-1-2-5-14/h1-6,9,15H,7H2,(H,13,16)(H,17,18) |
| InChIKey | BTOSSGRFWSDUNC-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |