About 2-amino-N-(2,3-dihydroxypropyl)-4-methyl-1,3-thiazole-5-carboxamide
2-amino-N-(2,3-dihydroxypropyl)-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 66168708) has the molecular formula C8H13N3O3S
and a molecular weight of 231.28 g/mol. Its IUPAC name is 2-amino-N-(2,3-dihydroxypropyl)-4-methyl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 2-amino-N-(2,3-dihydroxypropyl)-4-methyl-1,3-thiazole-5-carboxamide |
| PubChem CID | 66168708 |
| Molecular Formula | C8H13N3O3S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 2-amino-N-(2,3-dihydroxypropyl)-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(N)sc1C(=O)NCC(O)CO |
| InChI | InChI=1S/C8H13N3O3S/c1-4-6(15-8(9)11-4)7(14)10-2-5(13)3-12/h5,12-13H,2-3H2,1H3,(H2,9,11)(H,10,14) |
| InChIKey | JEQZVTGRCNLGEU-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-N-(2,3-dihydroxypropyl)-4-methyl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-(2,3-dihydroxypropyl)-4-methyl-1,3-thiazole-5-carboxamide?
The IUPAC name of 2-amino-N-(2,3-dihydroxypropyl)-4-methyl-1,3-thiazole-5-carboxamide (CID 66168708) is 2-amino-N-(2,3-dihydroxypropyl)-4-methyl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 2-amino-N-(2,3-dihydroxypropyl)-4-methyl-1,3-thiazole-5-carboxamide?
The canonical SMILES for 2-amino-N-(2,3-dihydroxypropyl)-4-methyl-1,3-thiazole-5-carboxamide is Cc1nc(N)sc1C(=O)NCC(O)CO.
What is the InChIKey of 2-amino-N-(2,3-dihydroxypropyl)-4-methyl-1,3-thiazole-5-carboxamide?
The InChIKey is JEQZVTGRCNLGEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O3S/c1-4-6(15-8(9)11-4)7(14)10-2-5(13)3-12/h5,12-13H,2-3H2,1H3,(H2,9,11)(H,10,14).
What are the key properties of 2-amino-N-(2,3-dihydroxypropyl)-4-methyl-1,3-thiazole-5-carboxamide?
2-amino-N-(2,3-dihydroxypropyl)-4-methyl-1,3-thiazole-5-carboxamide has a molecular weight of 231.28 g/mol, XLogP of -0.88, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-(2,3-dihydroxypropyl)-4-methyl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 66168708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).