About 3-[(2,3-dihydroxy-2-methylpropyl)amino]-1-propylpyrazin-2-one
3-[(2,3-dihydroxy-2-methylpropyl)amino]-1-propylpyrazin-2-one (PubChem CID 66168864) has the molecular formula C11H19N3O3
and a molecular weight of 241.29 g/mol. Its IUPAC name is 3-[(2,3-dihydroxy-2-methylpropyl)amino]-1-propylpyrazin-2-one.
Molecular Properties
| Compound Name | 3-[(2,3-dihydroxy-2-methylpropyl)amino]-1-propylpyrazin-2-one |
| PubChem CID | 66168864 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 3-[(2,3-dihydroxy-2-methylpropyl)amino]-1-propylpyrazin-2-one |
| SMILES | CCCn1ccnc(NCC(C)(O)CO)c1=O |
| InChI | InChI=1S/C11H19N3O3/c1-3-5-14-6-4-12-9(10(14)16)13-7-11(2,17)8-15/h4,6,15,17H,3,5,7-8H2,1-2H3,(H,12,13) |
| InChIKey | CQDPAXZVTVJVMB-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(2,3-dihydroxy-2-methylpropyl)amino]-1-propylpyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,3-dihydroxy-2-methylpropyl)amino]-1-propylpyrazin-2-one?
The IUPAC name of 3-[(2,3-dihydroxy-2-methylpropyl)amino]-1-propylpyrazin-2-one (CID 66168864) is 3-[(2,3-dihydroxy-2-methylpropyl)amino]-1-propylpyrazin-2-one.
What is the SMILES notation for 3-[(2,3-dihydroxy-2-methylpropyl)amino]-1-propylpyrazin-2-one?
The canonical SMILES for 3-[(2,3-dihydroxy-2-methylpropyl)amino]-1-propylpyrazin-2-one is CCCn1ccnc(NCC(C)(O)CO)c1=O.
What is the InChIKey of 3-[(2,3-dihydroxy-2-methylpropyl)amino]-1-propylpyrazin-2-one?
The InChIKey is CQDPAXZVTVJVMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O3/c1-3-5-14-6-4-12-9(10(14)16)13-7-11(2,17)8-15/h4,6,15,17H,3,5,7-8H2,1-2H3,(H,12,13).
What are the key properties of 3-[(2,3-dihydroxy-2-methylpropyl)amino]-1-propylpyrazin-2-one?
3-[(2,3-dihydroxy-2-methylpropyl)amino]-1-propylpyrazin-2-one has a molecular weight of 241.29 g/mol, XLogP of -0.19, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,3-dihydroxy-2-methylpropyl)amino]-1-propylpyrazin-2-one is sourced from PubChem (CID 66168864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).