About 3-[(4,6-dimethoxypyrimidin-5-yl)methylamino]-2-methylpropane-1,2-diol
3-[(4,6-dimethoxypyrimidin-5-yl)methylamino]-2-methylpropane-1,2-diol (PubChem CID 66168958) has the molecular formula C11H19N3O4
and a molecular weight of 257.29 g/mol. Its IUPAC name is 3-[(4,6-dimethoxypyrimidin-5-yl)methylamino]-2-methylpropane-1,2-diol.
Molecular Properties
| Compound Name | 3-[(4,6-dimethoxypyrimidin-5-yl)methylamino]-2-methylpropane-1,2-diol |
| PubChem CID | 66168958 |
| Molecular Formula | C11H19N3O4 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 3-[(4,6-dimethoxypyrimidin-5-yl)methylamino]-2-methylpropane-1,2-diol |
| SMILES | COc1ncnc(OC)c1CNCC(C)(O)CO |
| InChI | InChI=1S/C11H19N3O4/c1-11(16,6-15)5-12-4-8-9(17-2)13-7-14-10(8)18-3/h7,12,15-16H,4-6H2,1-3H3 |
| InChIKey | ARJIUWWDOWNZBO-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[(4,6-dimethoxypyrimidin-5-yl)methylamino]-2-methylpropane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4,6-dimethoxypyrimidin-5-yl)methylamino]-2-methylpropane-1,2-diol?
The IUPAC name of 3-[(4,6-dimethoxypyrimidin-5-yl)methylamino]-2-methylpropane-1,2-diol (CID 66168958) is 3-[(4,6-dimethoxypyrimidin-5-yl)methylamino]-2-methylpropane-1,2-diol.
What is the SMILES notation for 3-[(4,6-dimethoxypyrimidin-5-yl)methylamino]-2-methylpropane-1,2-diol?
The canonical SMILES for 3-[(4,6-dimethoxypyrimidin-5-yl)methylamino]-2-methylpropane-1,2-diol is COc1ncnc(OC)c1CNCC(C)(O)CO.
What is the InChIKey of 3-[(4,6-dimethoxypyrimidin-5-yl)methylamino]-2-methylpropane-1,2-diol?
The InChIKey is ARJIUWWDOWNZBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O4/c1-11(16,6-15)5-12-4-8-9(17-2)13-7-14-10(8)18-3/h7,12,15-16H,4-6H2,1-3H3.
What are the key properties of 3-[(4,6-dimethoxypyrimidin-5-yl)methylamino]-2-methylpropane-1,2-diol?
3-[(4,6-dimethoxypyrimidin-5-yl)methylamino]-2-methylpropane-1,2-diol has a molecular weight of 257.29 g/mol, XLogP of -0.67, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4,6-dimethoxypyrimidin-5-yl)methylamino]-2-methylpropane-1,2-diol is sourced from PubChem (CID 66168958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).