About N-(2,3-dihydroxy-2-methylpropyl)-3-methyl-1,2-oxazole-5-carboxamide
N-(2,3-dihydroxy-2-methylpropyl)-3-methyl-1,2-oxazole-5-carboxamide (PubChem CID 66168971) has the molecular formula C9H14N2O4
and a molecular weight of 214.22 g/mol. Its IUPAC name is N-(2,3-dihydroxy-2-methylpropyl)-3-methyl-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(2,3-dihydroxy-2-methylpropyl)-3-methyl-1,2-oxazole-5-carboxamide |
| PubChem CID | 66168971 |
| Molecular Formula | C9H14N2O4 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | N-(2,3-dihydroxy-2-methylpropyl)-3-methyl-1,2-oxazole-5-carboxamide |
| SMILES | Cc1cc(C(=O)NCC(C)(O)CO)on1 |
| InChI | InChI=1S/C9H14N2O4/c1-6-3-7(15-11-6)8(13)10-4-9(2,14)5-12/h3,12,14H,4-5H2,1-2H3,(H,10,13) |
| InChIKey | PPFBSWDOAAUIMQ-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2,3-dihydroxy-2-methylpropyl)-3-methyl-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dihydroxy-2-methylpropyl)-3-methyl-1,2-oxazole-5-carboxamide?
The IUPAC name of N-(2,3-dihydroxy-2-methylpropyl)-3-methyl-1,2-oxazole-5-carboxamide (CID 66168971) is N-(2,3-dihydroxy-2-methylpropyl)-3-methyl-1,2-oxazole-5-carboxamide.
What is the SMILES notation for N-(2,3-dihydroxy-2-methylpropyl)-3-methyl-1,2-oxazole-5-carboxamide?
The canonical SMILES for N-(2,3-dihydroxy-2-methylpropyl)-3-methyl-1,2-oxazole-5-carboxamide is Cc1cc(C(=O)NCC(C)(O)CO)on1.
What is the InChIKey of N-(2,3-dihydroxy-2-methylpropyl)-3-methyl-1,2-oxazole-5-carboxamide?
The InChIKey is PPFBSWDOAAUIMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O4/c1-6-3-7(15-11-6)8(13)10-4-9(2,14)5-12/h3,12,14H,4-5H2,1-2H3,(H,10,13).
What are the key properties of N-(2,3-dihydroxy-2-methylpropyl)-3-methyl-1,2-oxazole-5-carboxamide?
N-(2,3-dihydroxy-2-methylpropyl)-3-methyl-1,2-oxazole-5-carboxamide has a molecular weight of 214.22 g/mol, XLogP of -0.54, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dihydroxy-2-methylpropyl)-3-methyl-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 66168971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).