C10H13ClN2O3 — CID 66169235
6-chloro-N-(2,3-dihydroxy-2-methylpropyl)pyridine-3-carboxamide (PubChem CID 66169235) has the molecular formula C10H13ClN2O3 and a molecular weight of 244.68 g/mol. Its IUPAC name is 6-chloro-N-(2,3-dihydroxy-2-methylpropyl)pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-(2,3-dihydroxy-2-methylpropyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66169235 |
| Molecular Formula | C10H13ClN2O3 |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 6-chloro-N-(2,3-dihydroxy-2-methylpropyl)pyridine-3-carboxamide |
| SMILES | CC(O)(CO)CNC(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C10H13ClN2O3/c1-10(16,6-14)5-13-9(15)7-2-3-8(11)12-4-7/h2-4,14,16H,5-6H2,1H3,(H,13,15) |
| InChIKey | RVFZWASNIRZYFK-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|