C7H10ClN3O2 — CID 66169551
3-[(6-chloropyrimidin-4-yl)amino]propane-1,2-diol (PubChem CID 66169551) has the molecular formula C7H10ClN3O2 and a molecular weight of 203.63 g/mol. Its IUPAC name is 3-[(6-chloropyrimidin-4-yl)amino]propane-1,2-diol.
| Compound Name | 3-[(6-chloropyrimidin-4-yl)amino]propane-1,2-diol |
|---|---|
| PubChem CID | 66169551 |
| Molecular Formula | C7H10ClN3O2 |
| Molecular Weight | 203.63 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | 3-[(6-chloropyrimidin-4-yl)amino]propane-1,2-diol |
| SMILES | OCC(O)CNc1cc(Cl)ncn1 |
| InChI | InChI=1S/C7H10ClN3O2/c8-6-1-7(11-4-10-6)9-2-5(13)3-12/h1,4-5,12-13H,2-3H2,(H,9,10,11) |
| InChIKey | ZHWFHXVUPWABSK-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.63 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |