About 4-amino-N-(2,3-dihydroxy-2-methylpropyl)-1-methylpyrazole-3-carboxamide
4-amino-N-(2,3-dihydroxy-2-methylpropyl)-1-methylpyrazole-3-carboxamide (PubChem CID 66169769) has the molecular formula C9H16N4O3
and a molecular weight of 228.25 g/mol. Its IUPAC name is 4-amino-N-(2,3-dihydroxy-2-methylpropyl)-1-methylpyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 4-amino-N-(2,3-dihydroxy-2-methylpropyl)-1-methylpyrazole-3-carboxamide |
| PubChem CID | 66169769 |
| Molecular Formula | C9H16N4O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 4-amino-N-(2,3-dihydroxy-2-methylpropyl)-1-methylpyrazole-3-carboxamide |
| SMILES | Cn1cc(N)c(C(=O)NCC(C)(O)CO)n1 |
| InChI | InChI=1S/C9H16N4O3/c1-9(16,5-14)4-11-8(15)7-6(10)3-13(2)12-7/h3,14,16H,4-5,10H2,1-2H3,(H,11,15) |
| InChIKey | SPBISLOVGLODLU-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-amino-N-(2,3-dihydroxy-2-methylpropyl)-1-methylpyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-(2,3-dihydroxy-2-methylpropyl)-1-methylpyrazole-3-carboxamide?
The IUPAC name of 4-amino-N-(2,3-dihydroxy-2-methylpropyl)-1-methylpyrazole-3-carboxamide (CID 66169769) is 4-amino-N-(2,3-dihydroxy-2-methylpropyl)-1-methylpyrazole-3-carboxamide.
What is the SMILES notation for 4-amino-N-(2,3-dihydroxy-2-methylpropyl)-1-methylpyrazole-3-carboxamide?
The canonical SMILES for 4-amino-N-(2,3-dihydroxy-2-methylpropyl)-1-methylpyrazole-3-carboxamide is Cn1cc(N)c(C(=O)NCC(C)(O)CO)n1.
What is the InChIKey of 4-amino-N-(2,3-dihydroxy-2-methylpropyl)-1-methylpyrazole-3-carboxamide?
The InChIKey is SPBISLOVGLODLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4O3/c1-9(16,5-14)4-11-8(15)7-6(10)3-13(2)12-7/h3,14,16H,4-5,10H2,1-2H3,(H,11,15).
What are the key properties of 4-amino-N-(2,3-dihydroxy-2-methylpropyl)-1-methylpyrazole-3-carboxamide?
4-amino-N-(2,3-dihydroxy-2-methylpropyl)-1-methylpyrazole-3-carboxamide has a molecular weight of 228.25 g/mol, XLogP of -1.52, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-(2,3-dihydroxy-2-methylpropyl)-1-methylpyrazole-3-carboxamide is sourced from PubChem (CID 66169769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).