About 3-[(3-chloropyrazin-2-yl)amino]propane-1,2-diol
3-[(3-chloropyrazin-2-yl)amino]propane-1,2-diol (PubChem CID 66169969) has the molecular formula C7H10ClN3O2
and a molecular weight of 203.63 g/mol. Its IUPAC name is 3-[(3-chloropyrazin-2-yl)amino]propane-1,2-diol.
Molecular Properties
| Compound Name | 3-[(3-chloropyrazin-2-yl)amino]propane-1,2-diol |
| PubChem CID | 66169969 |
| Molecular Formula | C7H10ClN3O2 |
| Molecular Weight | 203.63 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | 3-[(3-chloropyrazin-2-yl)amino]propane-1,2-diol |
| SMILES | OCC(O)CNc1nccnc1Cl |
| InChI | InChI=1S/C7H10ClN3O2/c8-6-7(10-2-1-9-6)11-3-5(13)4-12/h1-2,5,12-13H,3-4H2,(H,10,11) |
| InChIKey | XSIDUWKHGZIKNF-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.63 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(3-chloropyrazin-2-yl)amino]propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-chloropyrazin-2-yl)amino]propane-1,2-diol?
The IUPAC name of 3-[(3-chloropyrazin-2-yl)amino]propane-1,2-diol (CID 66169969) is 3-[(3-chloropyrazin-2-yl)amino]propane-1,2-diol.
What is the SMILES notation for 3-[(3-chloropyrazin-2-yl)amino]propane-1,2-diol?
The canonical SMILES for 3-[(3-chloropyrazin-2-yl)amino]propane-1,2-diol is OCC(O)CNc1nccnc1Cl.
What is the InChIKey of 3-[(3-chloropyrazin-2-yl)amino]propane-1,2-diol?
The InChIKey is XSIDUWKHGZIKNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10ClN3O2/c8-6-7(10-2-1-9-6)11-3-5(13)4-12/h1-2,5,12-13H,3-4H2,(H,10,11).
What are the key properties of 3-[(3-chloropyrazin-2-yl)amino]propane-1,2-diol?
3-[(3-chloropyrazin-2-yl)amino]propane-1,2-diol has a molecular weight of 203.63 g/mol, XLogP of -0.10, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-chloropyrazin-2-yl)amino]propane-1,2-diol is sourced from PubChem (CID 66169969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).