About 2-methyl-3-(tetrazolo[1,5-a]pyrazin-5-ylamino)propane-1,2-diol
2-methyl-3-(tetrazolo[1,5-a]pyrazin-5-ylamino)propane-1,2-diol (PubChem CID 66170333) has the molecular formula C8H12N6O2
and a molecular weight of 224.22 g/mol. Its IUPAC name is 2-methyl-3-(tetrazolo[1,5-a]pyrazin-5-ylamino)propane-1,2-diol.
Molecular Properties
| Compound Name | 2-methyl-3-(tetrazolo[1,5-a]pyrazin-5-ylamino)propane-1,2-diol |
| PubChem CID | 66170333 |
| Molecular Formula | C8H12N6O2 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 2-methyl-3-(tetrazolo[1,5-a]pyrazin-5-ylamino)propane-1,2-diol |
| SMILES | CC(O)(CO)CNc1cncc2nnnn12 |
| InChI | InChI=1S/C8H12N6O2/c1-8(16,5-15)4-10-6-2-9-3-7-11-12-13-14(6)7/h2-3,10,15-16H,4-5H2,1H3 |
| InChIKey | VJZOYYMQPUIEFE-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 108.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-methyl-3-(tetrazolo[1,5-a]pyrazin-5-ylamino)propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-(tetrazolo[1,5-a]pyrazin-5-ylamino)propane-1,2-diol?
The IUPAC name of 2-methyl-3-(tetrazolo[1,5-a]pyrazin-5-ylamino)propane-1,2-diol (CID 66170333) is 2-methyl-3-(tetrazolo[1,5-a]pyrazin-5-ylamino)propane-1,2-diol.
What is the SMILES notation for 2-methyl-3-(tetrazolo[1,5-a]pyrazin-5-ylamino)propane-1,2-diol?
The canonical SMILES for 2-methyl-3-(tetrazolo[1,5-a]pyrazin-5-ylamino)propane-1,2-diol is CC(O)(CO)CNc1cncc2nnnn12.
What is the InChIKey of 2-methyl-3-(tetrazolo[1,5-a]pyrazin-5-ylamino)propane-1,2-diol?
The InChIKey is VJZOYYMQPUIEFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N6O2/c1-8(16,5-15)4-10-6-2-9-3-7-11-12-13-14(6)7/h2-3,10,15-16H,4-5H2,1H3.
What are the key properties of 2-methyl-3-(tetrazolo[1,5-a]pyrazin-5-ylamino)propane-1,2-diol?
2-methyl-3-(tetrazolo[1,5-a]pyrazin-5-ylamino)propane-1,2-diol has a molecular weight of 224.22 g/mol, XLogP of -1.33, 4 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-(tetrazolo[1,5-a]pyrazin-5-ylamino)propane-1,2-diol is sourced from PubChem (CID 66170333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).