C14H21NO5 — CID 66170410
N-(2,3-dihydroxy-2-methylpropyl)-2-(4-ethoxyphenoxy)acetamide (PubChem CID 66170410) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is N-(2,3-dihydroxy-2-methylpropyl)-2-(4-ethoxyphenoxy)acetamide.
| Compound Name | N-(2,3-dihydroxy-2-methylpropyl)-2-(4-ethoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 66170410 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | N-(2,3-dihydroxy-2-methylpropyl)-2-(4-ethoxyphenoxy)acetamide |
| SMILES | CCOc1ccc(OCC(=O)NCC(C)(O)CO)cc1 |
| InChI | InChI=1S/C14H21NO5/c1-3-19-11-4-6-12(7-5-11)20-8-13(17)15-9-14(2,18)10-16/h4-7,16,18H,3,8-10H2,1-2H3,(H,15,17) |
| InChIKey | WGEAJNRWFBYQCP-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |