C19H23N3O3S — CID 661706
1,3-diethyl-6-hydroxy-2-sulfanylidene-5-[2-(1,2,3,4-tetrahydroisoquinolin-1-yl)acetyl]pyrimidin-4-one (PubChem CID 661706) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is 1,3-diethyl-6-hydroxy-2-sulfanylidene-5-[2-(1,2,3,4-tetrahydroisoquinolin-1-yl)acetyl]pyrimidin-4-one.
| Compound Name | 1,3-diethyl-6-hydroxy-2-sulfanylidene-5-[2-(1,2,3,4-tetrahydroisoquinolin-1-yl)acetyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 661706 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 1,3-diethyl-6-hydroxy-2-sulfanylidene-5-[2-(1,2,3,4-tetrahydroisoquinolin-1-yl)acetyl]pyrimidin-4-one |
| SMILES | CCn1c(O)c(C(=O)CC2NCCc3ccccc32)c(=O)n(CC)c1=S |
| InChI | InChI=1S/C19H23N3O3S/c1-3-21-17(24)16(18(25)22(4-2)19(21)26)15(23)11-14-13-8-6-5-7-12(13)9-10-20-14/h5-8,14,20,24H,3-4,9-11H2,1-2H3 |
| InChIKey | ZMBLEUBXFDKDAL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|