C13H18N4 — CID 661709
8-(2-methylpropyl)-4,5,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraen-3-amine (PubChem CID 661709) has the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. Its IUPAC name is 8-(2-methylpropyl)-4,5,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraen-3-amine.
| Compound Name | 8-(2-methylpropyl)-4,5,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraen-3-amine |
|---|---|
| PubChem CID | 661709 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 8-(2-methylpropyl)-4,5,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraen-3-amine |
| SMILES | CC(C)Cc1nc2n[nH]c(N)c2c2c1CCC2 |
| InChI | InChI=1S/C13H18N4/c1-7(2)6-10-8-4-3-5-9(8)11-12(14)16-17-13(11)15-10/h7H,3-6H2,1-2H3,(H3,14,15,16,17) |
| InChIKey | YBCQZRZPQCTREM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |