About N-(2-hydroxy-2,4-dimethylpentyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide
N-(2-hydroxy-2,4-dimethylpentyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide (PubChem CID 66172066) has the molecular formula C13H23F3N2O2
and a molecular weight of 296.33 g/mol. Its IUPAC name is N-(2-hydroxy-2,4-dimethylpentyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide.
Molecular Properties
| Compound Name | N-(2-hydroxy-2,4-dimethylpentyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide |
| PubChem CID | 66172066 |
| Molecular Formula | C13H23F3N2O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | N-(2-hydroxy-2,4-dimethylpentyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide |
| SMILES | CC(C)CC(C)(O)CNC(=O)C1(C(F)(F)F)CCNC1 |
| InChI | InChI=1S/C13H23F3N2O2/c1-9(2)6-11(3,20)7-18-10(19)12(13(14,15)16)4-5-17-8-12/h9,17,20H,4-8H2,1-3H3,(H,18,19) |
| InChIKey | GELXLDFBTFADPC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-hydroxy-2,4-dimethylpentyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxy-2,4-dimethylpentyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide?
The IUPAC name of N-(2-hydroxy-2,4-dimethylpentyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide (CID 66172066) is N-(2-hydroxy-2,4-dimethylpentyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide.
What is the SMILES notation for N-(2-hydroxy-2,4-dimethylpentyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide?
The canonical SMILES for N-(2-hydroxy-2,4-dimethylpentyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide is CC(C)CC(C)(O)CNC(=O)C1(C(F)(F)F)CCNC1.
What is the InChIKey of N-(2-hydroxy-2,4-dimethylpentyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide?
The InChIKey is GELXLDFBTFADPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23F3N2O2/c1-9(2)6-11(3,20)7-18-10(19)12(13(14,15)16)4-5-17-8-12/h9,17,20H,4-8H2,1-3H3,(H,18,19).
What are the key properties of N-(2-hydroxy-2,4-dimethylpentyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide?
N-(2-hydroxy-2,4-dimethylpentyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide has a molecular weight of 296.33 g/mol, XLogP of 1.44, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxy-2,4-dimethylpentyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide is sourced from PubChem (CID 66172066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).