About 4-nitro-7-N-phenyl-2,1,3-benzoxadiazole-5,7-diamine
4-nitro-7-N-phenyl-2,1,3-benzoxadiazole-5,7-diamine (PubChem CID 6617300) has the molecular formula C12H9N5O3
and a molecular weight of 271.24 g/mol. Its IUPAC name is 4-nitro-7-N-phenyl-2,1,3-benzoxadiazole-5,7-diamine.
Molecular Properties
| Compound Name | 4-nitro-7-N-phenyl-2,1,3-benzoxadiazole-5,7-diamine |
| PubChem CID | 6617300 |
| Molecular Formula | C12H9N5O3 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 4-nitro-7-N-phenyl-2,1,3-benzoxadiazole-5,7-diamine |
| SMILES | Nc1cc(Nc2ccccc2)c2nonc2c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H9N5O3/c13-8-6-9(14-7-4-2-1-3-5-7)10-11(16-20-15-10)12(8)17(18)19/h1-6,14H,13H2 |
| InChIKey | NCUGRABFFNHPIF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 120.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitro-7-N-phenyl-2,1,3-benzoxadiazole-5,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitro-7-N-phenyl-2,1,3-benzoxadiazole-5,7-diamine?
The IUPAC name of 4-nitro-7-N-phenyl-2,1,3-benzoxadiazole-5,7-diamine (CID 6617300) is 4-nitro-7-N-phenyl-2,1,3-benzoxadiazole-5,7-diamine.
What is the SMILES notation for 4-nitro-7-N-phenyl-2,1,3-benzoxadiazole-5,7-diamine?
The canonical SMILES for 4-nitro-7-N-phenyl-2,1,3-benzoxadiazole-5,7-diamine is Nc1cc(Nc2ccccc2)c2nonc2c1[N+](=O)[O-].
What is the InChIKey of 4-nitro-7-N-phenyl-2,1,3-benzoxadiazole-5,7-diamine?
The InChIKey is NCUGRABFFNHPIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N5O3/c13-8-6-9(14-7-4-2-1-3-5-7)10-11(16-20-15-10)12(8)17(18)19/h1-6,14H,13H2.
What are the key properties of 4-nitro-7-N-phenyl-2,1,3-benzoxadiazole-5,7-diamine?
4-nitro-7-N-phenyl-2,1,3-benzoxadiazole-5,7-diamine has a molecular weight of 271.24 g/mol, XLogP of 2.46, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitro-7-N-phenyl-2,1,3-benzoxadiazole-5,7-diamine is sourced from PubChem (CID 6617300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).