C8H14N2O6 — CID 66173456
2-hydroxy-3-[(2-methoxy-2-oxoethyl)carbamoylamino]-2-methylpropanoic acid (PubChem CID 66173456) has the molecular formula C8H14N2O6 and a molecular weight of 234.21 g/mol. Its IUPAC name is 2-hydroxy-3-[(2-methoxy-2-oxoethyl)carbamoylamino]-2-methylpropanoic acid.
| Compound Name | 2-hydroxy-3-[(2-methoxy-2-oxoethyl)carbamoylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 66173456 |
| Molecular Formula | C8H14N2O6 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 2-hydroxy-3-[(2-methoxy-2-oxoethyl)carbamoylamino]-2-methylpropanoic acid |
| SMILES | COC(=O)CNC(=O)NCC(C)(O)C(=O)O |
| InChI | InChI=1S/C8H14N2O6/c1-8(15,6(12)13)4-10-7(14)9-3-5(11)16-2/h15H,3-4H2,1-2H3,(H,12,13)(H2,9,10,14) |
| InChIKey | IPXGDMQKGNQKGQ-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |