About 4-[(2-hydroxy-2,4-dimethylpentyl)amino]-1,1-dioxothiolan-3-ol
4-[(2-hydroxy-2,4-dimethylpentyl)amino]-1,1-dioxothiolan-3-ol (PubChem CID 66174660) has the molecular formula C11H23NO4S
and a molecular weight of 265.37 g/mol. Its IUPAC name is 4-[(2-hydroxy-2,4-dimethylpentyl)amino]-1,1-dioxothiolan-3-ol.
Molecular Properties
| Compound Name | 4-[(2-hydroxy-2,4-dimethylpentyl)amino]-1,1-dioxothiolan-3-ol |
| PubChem CID | 66174660 |
| Molecular Formula | C11H23NO4S |
| Molecular Weight | 265.37 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 4-[(2-hydroxy-2,4-dimethylpentyl)amino]-1,1-dioxothiolan-3-ol |
| SMILES | CC(C)CC(C)(O)CNC1CS(=O)(=O)CC1O |
| InChI | InChI=1S/C11H23NO4S/c1-8(2)4-11(3,14)7-12-9-5-17(15,16)6-10(9)13/h8-10,12-14H,4-7H2,1-3H3 |
| InChIKey | QPJJXLLGMSFDSA-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.37 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(2-hydroxy-2,4-dimethylpentyl)amino]-1,1-dioxothiolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-hydroxy-2,4-dimethylpentyl)amino]-1,1-dioxothiolan-3-ol?
The IUPAC name of 4-[(2-hydroxy-2,4-dimethylpentyl)amino]-1,1-dioxothiolan-3-ol (CID 66174660) is 4-[(2-hydroxy-2,4-dimethylpentyl)amino]-1,1-dioxothiolan-3-ol.
What is the SMILES notation for 4-[(2-hydroxy-2,4-dimethylpentyl)amino]-1,1-dioxothiolan-3-ol?
The canonical SMILES for 4-[(2-hydroxy-2,4-dimethylpentyl)amino]-1,1-dioxothiolan-3-ol is CC(C)CC(C)(O)CNC1CS(=O)(=O)CC1O.
What is the InChIKey of 4-[(2-hydroxy-2,4-dimethylpentyl)amino]-1,1-dioxothiolan-3-ol?
The InChIKey is QPJJXLLGMSFDSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO4S/c1-8(2)4-11(3,14)7-12-9-5-17(15,16)6-10(9)13/h8-10,12-14H,4-7H2,1-3H3.
What are the key properties of 4-[(2-hydroxy-2,4-dimethylpentyl)amino]-1,1-dioxothiolan-3-ol?
4-[(2-hydroxy-2,4-dimethylpentyl)amino]-1,1-dioxothiolan-3-ol has a molecular weight of 265.37 g/mol, XLogP of -0.47, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-hydroxy-2,4-dimethylpentyl)amino]-1,1-dioxothiolan-3-ol is sourced from PubChem (CID 66174660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).