About N-(2,3-dihydroxypropyl)-1,4-dioxane-2-carboxamide
N-(2,3-dihydroxypropyl)-1,4-dioxane-2-carboxamide (PubChem CID 66175400) has the molecular formula C8H15NO5
and a molecular weight of 205.21 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-1,4-dioxane-2-carboxamide.
Molecular Properties
| Compound Name | N-(2,3-dihydroxypropyl)-1,4-dioxane-2-carboxamide |
| PubChem CID | 66175400 |
| Molecular Formula | C8H15NO5 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-1,4-dioxane-2-carboxamide |
| SMILES | O=C(NCC(O)CO)C1COCCO1 |
| InChI | InChI=1S/C8H15NO5/c10-4-6(11)3-9-8(12)7-5-13-1-2-14-7/h6-7,10-11H,1-5H2,(H,9,12) |
| InChIKey | JDRDJMALZVOBHG-UHFFFAOYSA-N |
| XLogP | -2.13 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2,3-dihydroxypropyl)-1,4-dioxane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dihydroxypropyl)-1,4-dioxane-2-carboxamide?
The IUPAC name of N-(2,3-dihydroxypropyl)-1,4-dioxane-2-carboxamide (CID 66175400) is N-(2,3-dihydroxypropyl)-1,4-dioxane-2-carboxamide.
What is the SMILES notation for N-(2,3-dihydroxypropyl)-1,4-dioxane-2-carboxamide?
The canonical SMILES for N-(2,3-dihydroxypropyl)-1,4-dioxane-2-carboxamide is O=C(NCC(O)CO)C1COCCO1.
What is the InChIKey of N-(2,3-dihydroxypropyl)-1,4-dioxane-2-carboxamide?
The InChIKey is JDRDJMALZVOBHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO5/c10-4-6(11)3-9-8(12)7-5-13-1-2-14-7/h6-7,10-11H,1-5H2,(H,9,12).
What are the key properties of N-(2,3-dihydroxypropyl)-1,4-dioxane-2-carboxamide?
N-(2,3-dihydroxypropyl)-1,4-dioxane-2-carboxamide has a molecular weight of 205.21 g/mol, XLogP of -2.13, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dihydroxypropyl)-1,4-dioxane-2-carboxamide is sourced from PubChem (CID 66175400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).