About N-(2,3-dihydroxypropyl)-2-(2-oxopyrimidin-1-yl)acetamide
N-(2,3-dihydroxypropyl)-2-(2-oxopyrimidin-1-yl)acetamide (PubChem CID 66175803) has the molecular formula C9H13N3O4
and a molecular weight of 227.22 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-2-(2-oxopyrimidin-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(2,3-dihydroxypropyl)-2-(2-oxopyrimidin-1-yl)acetamide |
| PubChem CID | 66175803 |
| Molecular Formula | C9H13N3O4 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-2-(2-oxopyrimidin-1-yl)acetamide |
| SMILES | O=C(Cn1cccnc1=O)NCC(O)CO |
| InChI | InChI=1S/C9H13N3O4/c13-6-7(14)4-11-8(15)5-12-3-1-2-10-9(12)16/h1-3,7,13-14H,4-6H2,(H,11,15) |
| InChIKey | WGMXOYOSOYYMIM-UHFFFAOYSA-N |
| XLogP | -2.29 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(2,3-dihydroxypropyl)-2-(2-oxopyrimidin-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dihydroxypropyl)-2-(2-oxopyrimidin-1-yl)acetamide?
The IUPAC name of N-(2,3-dihydroxypropyl)-2-(2-oxopyrimidin-1-yl)acetamide (CID 66175803) is N-(2,3-dihydroxypropyl)-2-(2-oxopyrimidin-1-yl)acetamide.
What is the SMILES notation for N-(2,3-dihydroxypropyl)-2-(2-oxopyrimidin-1-yl)acetamide?
The canonical SMILES for N-(2,3-dihydroxypropyl)-2-(2-oxopyrimidin-1-yl)acetamide is O=C(Cn1cccnc1=O)NCC(O)CO.
What is the InChIKey of N-(2,3-dihydroxypropyl)-2-(2-oxopyrimidin-1-yl)acetamide?
The InChIKey is WGMXOYOSOYYMIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O4/c13-6-7(14)4-11-8(15)5-12-3-1-2-10-9(12)16/h1-3,7,13-14H,4-6H2,(H,11,15).
What are the key properties of N-(2,3-dihydroxypropyl)-2-(2-oxopyrimidin-1-yl)acetamide?
N-(2,3-dihydroxypropyl)-2-(2-oxopyrimidin-1-yl)acetamide has a molecular weight of 227.22 g/mol, XLogP of -2.29, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dihydroxypropyl)-2-(2-oxopyrimidin-1-yl)acetamide is sourced from PubChem (CID 66175803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).