C11H23N3O4 — CID 66176598
3-[[3-(dimethylamino)propyl-methylcarbamoyl]amino]-2-hydroxy-2-methylpropanoic acid (PubChem CID 66176598) has the molecular formula C11H23N3O4 and a molecular weight of 261.32 g/mol. Its IUPAC name is 3-[[3-(dimethylamino)propyl-methylcarbamoyl]amino]-2-hydroxy-2-methylpropanoic acid.
| Compound Name | 3-[[3-(dimethylamino)propyl-methylcarbamoyl]amino]-2-hydroxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 66176598 |
| Molecular Formula | C11H23N3O4 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 3-[[3-(dimethylamino)propyl-methylcarbamoyl]amino]-2-hydroxy-2-methylpropanoic acid |
| SMILES | CN(C)CCCN(C)C(=O)NCC(C)(O)C(=O)O |
| InChI | InChI=1S/C11H23N3O4/c1-11(18,9(15)16)8-12-10(17)14(4)7-5-6-13(2)3/h18H,5-8H2,1-4H3,(H,12,17)(H,15,16) |
| InChIKey | VUGQYTFIGLVZQM-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |