C11H24N2O2 — CID 66176759
3-[1-(1-methylpiperidin-3-yl)ethylamino]propane-1,2-diol (PubChem CID 66176759) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is 3-[1-(1-methylpiperidin-3-yl)ethylamino]propane-1,2-diol.
| Compound Name | 3-[1-(1-methylpiperidin-3-yl)ethylamino]propane-1,2-diol |
|---|---|
| PubChem CID | 66176759 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 3-[1-(1-methylpiperidin-3-yl)ethylamino]propane-1,2-diol |
| SMILES | CC(NCC(O)CO)C1CCCN(C)C1 |
| InChI | InChI=1S/C11H24N2O2/c1-9(12-6-11(15)8-14)10-4-3-5-13(2)7-10/h9-12,14-15H,3-8H2,1-2H3 |
| InChIKey | HJEAPCORVXTZCB-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |