C5H9N3O2S — CID 66176924
3-(1,2,4-thiadiazol-5-ylamino)propane-1,2-diol (PubChem CID 66176924) has the molecular formula C5H9N3O2S and a molecular weight of 175.21 g/mol. Its IUPAC name is 3-(1,2,4-thiadiazol-5-ylamino)propane-1,2-diol.
| Compound Name | 3-(1,2,4-thiadiazol-5-ylamino)propane-1,2-diol |
|---|---|
| PubChem CID | 66176924 |
| Molecular Formula | C5H9N3O2S |
| Molecular Weight | 175.21 g/mol |
| Exact Mass | 175.04 |
| IUPAC Name | 3-(1,2,4-thiadiazol-5-ylamino)propane-1,2-diol |
| SMILES | OCC(O)CNc1ncns1 |
| InChI | InChI=1S/C5H9N3O2S/c9-2-4(10)1-6-5-7-3-8-11-5/h3-4,9-10H,1-2H2,(H,6,7,8) |
| InChIKey | SKCLLAVINYVNAT-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.21 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |