About N-(2,3-dihydroxypropyl)-2-(3,6-dioxo-1H-pyridazin-2-yl)acetamide
N-(2,3-dihydroxypropyl)-2-(3,6-dioxo-1H-pyridazin-2-yl)acetamide (PubChem CID 66177479) has the molecular formula C9H13N3O5
and a molecular weight of 243.22 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-2-(3,6-dioxo-1H-pyridazin-2-yl)acetamide.
Molecular Properties
| Compound Name | N-(2,3-dihydroxypropyl)-2-(3,6-dioxo-1H-pyridazin-2-yl)acetamide |
| PubChem CID | 66177479 |
| Molecular Formula | C9H13N3O5 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-2-(3,6-dioxo-1H-pyridazin-2-yl)acetamide |
| SMILES | O=C(Cn1[nH]c(=O)ccc1=O)NCC(O)CO |
| InChI | InChI=1S/C9H13N3O5/c13-5-6(14)3-10-8(16)4-12-9(17)2-1-7(15)11-12/h1-2,6,13-14H,3-5H2,(H,10,16)(H,11,15) |
| InChIKey | CCPRATBRPMLZHU-UHFFFAOYSA-N |
| XLogP | -2.99 |
| TPSA | 124.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(2,3-dihydroxypropyl)-2-(3,6-dioxo-1H-pyridazin-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dihydroxypropyl)-2-(3,6-dioxo-1H-pyridazin-2-yl)acetamide?
The IUPAC name of N-(2,3-dihydroxypropyl)-2-(3,6-dioxo-1H-pyridazin-2-yl)acetamide (CID 66177479) is N-(2,3-dihydroxypropyl)-2-(3,6-dioxo-1H-pyridazin-2-yl)acetamide.
What is the SMILES notation for N-(2,3-dihydroxypropyl)-2-(3,6-dioxo-1H-pyridazin-2-yl)acetamide?
The canonical SMILES for N-(2,3-dihydroxypropyl)-2-(3,6-dioxo-1H-pyridazin-2-yl)acetamide is O=C(Cn1[nH]c(=O)ccc1=O)NCC(O)CO.
What is the InChIKey of N-(2,3-dihydroxypropyl)-2-(3,6-dioxo-1H-pyridazin-2-yl)acetamide?
The InChIKey is CCPRATBRPMLZHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O5/c13-5-6(14)3-10-8(16)4-12-9(17)2-1-7(15)11-12/h1-2,6,13-14H,3-5H2,(H,10,16)(H,11,15).
What are the key properties of N-(2,3-dihydroxypropyl)-2-(3,6-dioxo-1H-pyridazin-2-yl)acetamide?
N-(2,3-dihydroxypropyl)-2-(3,6-dioxo-1H-pyridazin-2-yl)acetamide has a molecular weight of 243.22 g/mol, XLogP of -2.99, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dihydroxypropyl)-2-(3,6-dioxo-1H-pyridazin-2-yl)acetamide is sourced from PubChem (CID 66177479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).