About 1-[[butyl(methyl)sulfamoyl]amino]-2-hydroxy-2,4-dimethylpentane
1-[[butyl(methyl)sulfamoyl]amino]-2-hydroxy-2,4-dimethylpentane (PubChem CID 66178603) has the molecular formula C12H28N2O3S
and a molecular weight of 280.43 g/mol. Its IUPAC name is 1-[[butyl(methyl)sulfamoyl]amino]-2-hydroxy-2,4-dimethylpentane.
Molecular Properties
| Compound Name | 1-[[butyl(methyl)sulfamoyl]amino]-2-hydroxy-2,4-dimethylpentane |
| PubChem CID | 66178603 |
| Molecular Formula | C12H28N2O3S |
| Molecular Weight | 280.43 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 1-[[butyl(methyl)sulfamoyl]amino]-2-hydroxy-2,4-dimethylpentane |
| SMILES | CCCCN(C)S(=O)(=O)NCC(C)(O)CC(C)C |
| InChI | InChI=1S/C12H28N2O3S/c1-6-7-8-14(5)18(16,17)13-10-12(4,15)9-11(2)3/h11,13,15H,6-10H2,1-5H3 |
| InChIKey | DVEXWVDGZNBTIE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.43 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[butyl(methyl)sulfamoyl]amino]-2-hydroxy-2,4-dimethylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[butyl(methyl)sulfamoyl]amino]-2-hydroxy-2,4-dimethylpentane?
The IUPAC name of 1-[[butyl(methyl)sulfamoyl]amino]-2-hydroxy-2,4-dimethylpentane (CID 66178603) is 1-[[butyl(methyl)sulfamoyl]amino]-2-hydroxy-2,4-dimethylpentane.
What is the SMILES notation for 1-[[butyl(methyl)sulfamoyl]amino]-2-hydroxy-2,4-dimethylpentane?
The canonical SMILES for 1-[[butyl(methyl)sulfamoyl]amino]-2-hydroxy-2,4-dimethylpentane is CCCCN(C)S(=O)(=O)NCC(C)(O)CC(C)C.
What is the InChIKey of 1-[[butyl(methyl)sulfamoyl]amino]-2-hydroxy-2,4-dimethylpentane?
The InChIKey is DVEXWVDGZNBTIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28N2O3S/c1-6-7-8-14(5)18(16,17)13-10-12(4,15)9-11(2)3/h11,13,15H,6-10H2,1-5H3.
What are the key properties of 1-[[butyl(methyl)sulfamoyl]amino]-2-hydroxy-2,4-dimethylpentane?
1-[[butyl(methyl)sulfamoyl]amino]-2-hydroxy-2,4-dimethylpentane has a molecular weight of 280.43 g/mol, XLogP of 1.35, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[butyl(methyl)sulfamoyl]amino]-2-hydroxy-2,4-dimethylpentane is sourced from PubChem (CID 66178603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).