C17H27NO3 — CID 66178761
N-(2-hydroxy-2,4-dimethylpentyl)-3-propoxybenzamide (PubChem CID 66178761) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is N-(2-hydroxy-2,4-dimethylpentyl)-3-propoxybenzamide.
| Compound Name | N-(2-hydroxy-2,4-dimethylpentyl)-3-propoxybenzamide |
|---|---|
| PubChem CID | 66178761 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | N-(2-hydroxy-2,4-dimethylpentyl)-3-propoxybenzamide |
| SMILES | CCCOc1cccc(C(=O)NCC(C)(O)CC(C)C)c1 |
| InChI | InChI=1S/C17H27NO3/c1-5-9-21-15-8-6-7-14(10-15)16(19)18-12-17(4,20)11-13(2)3/h6-8,10,13,20H,5,9,11-12H2,1-4H3,(H,18,19) |
| InChIKey | YXBABLAYFYLORV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |