About 1-[1-(2,5-dimethylthiophen-3-yl)ethylamino]-2,4-dimethylpentan-2-ol
1-[1-(2,5-dimethylthiophen-3-yl)ethylamino]-2,4-dimethylpentan-2-ol (PubChem CID 66179370) has the molecular formula C15H27NOS
and a molecular weight of 269.45 g/mol. Its IUPAC name is 1-[1-(2,5-dimethylthiophen-3-yl)ethylamino]-2,4-dimethylpentan-2-ol.
Molecular Properties
| Compound Name | 1-[1-(2,5-dimethylthiophen-3-yl)ethylamino]-2,4-dimethylpentan-2-ol |
| PubChem CID | 66179370 |
| Molecular Formula | C15H27NOS |
| Molecular Weight | 269.45 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | 1-[1-(2,5-dimethylthiophen-3-yl)ethylamino]-2,4-dimethylpentan-2-ol |
| SMILES | Cc1cc(C(C)NCC(C)(O)CC(C)C)c(C)s1 |
| InChI | InChI=1S/C15H27NOS/c1-10(2)8-15(6,17)9-16-12(4)14-7-11(3)18-13(14)5/h7,10,12,16-17H,8-9H2,1-6H3 |
| InChIKey | SCBCVVNZIVIIQI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[1-(2,5-dimethylthiophen-3-yl)ethylamino]-2,4-dimethylpentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(2,5-dimethylthiophen-3-yl)ethylamino]-2,4-dimethylpentan-2-ol?
The IUPAC name of 1-[1-(2,5-dimethylthiophen-3-yl)ethylamino]-2,4-dimethylpentan-2-ol (CID 66179370) is 1-[1-(2,5-dimethylthiophen-3-yl)ethylamino]-2,4-dimethylpentan-2-ol.
What is the SMILES notation for 1-[1-(2,5-dimethylthiophen-3-yl)ethylamino]-2,4-dimethylpentan-2-ol?
The canonical SMILES for 1-[1-(2,5-dimethylthiophen-3-yl)ethylamino]-2,4-dimethylpentan-2-ol is Cc1cc(C(C)NCC(C)(O)CC(C)C)c(C)s1.
What is the InChIKey of 1-[1-(2,5-dimethylthiophen-3-yl)ethylamino]-2,4-dimethylpentan-2-ol?
The InChIKey is SCBCVVNZIVIIQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NOS/c1-10(2)8-15(6,17)9-16-12(4)14-7-11(3)18-13(14)5/h7,10,12,16-17H,8-9H2,1-6H3.
What are the key properties of 1-[1-(2,5-dimethylthiophen-3-yl)ethylamino]-2,4-dimethylpentan-2-ol?
1-[1-(2,5-dimethylthiophen-3-yl)ethylamino]-2,4-dimethylpentan-2-ol has a molecular weight of 269.45 g/mol, XLogP of 3.81, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(2,5-dimethylthiophen-3-yl)ethylamino]-2,4-dimethylpentan-2-ol is sourced from PubChem (CID 66179370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).