About 1-(2-adamantylamino)-2,4-dimethylpentan-2-ol
1-(2-adamantylamino)-2,4-dimethylpentan-2-ol (PubChem CID 66179718) has the molecular formula C17H31NO
and a molecular weight of 265.44 g/mol. Its IUPAC name is 1-(2-adamantylamino)-2,4-dimethylpentan-2-ol.
Molecular Properties
| Compound Name | 1-(2-adamantylamino)-2,4-dimethylpentan-2-ol |
| PubChem CID | 66179718 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | 1-(2-adamantylamino)-2,4-dimethylpentan-2-ol |
| SMILES | CC(C)CC(C)(O)CNC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C17H31NO/c1-11(2)9-17(3,19)10-18-16-14-5-12-4-13(7-14)8-15(16)6-12/h11-16,18-19H,4-10H2,1-3H3 |
| InChIKey | DFLMGLWDRPXECT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2-adamantylamino)-2,4-dimethylpentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-adamantylamino)-2,4-dimethylpentan-2-ol?
The IUPAC name of 1-(2-adamantylamino)-2,4-dimethylpentan-2-ol (CID 66179718) is 1-(2-adamantylamino)-2,4-dimethylpentan-2-ol.
What is the SMILES notation for 1-(2-adamantylamino)-2,4-dimethylpentan-2-ol?
The canonical SMILES for 1-(2-adamantylamino)-2,4-dimethylpentan-2-ol is CC(C)CC(C)(O)CNC1C2CC3CC(C2)CC1C3.
What is the InChIKey of 1-(2-adamantylamino)-2,4-dimethylpentan-2-ol?
The InChIKey is DFLMGLWDRPXECT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H31NO/c1-11(2)9-17(3,19)10-18-16-14-5-12-4-13(7-14)8-15(16)6-12/h11-16,18-19H,4-10H2,1-3H3.
What are the key properties of 1-(2-adamantylamino)-2,4-dimethylpentan-2-ol?
1-(2-adamantylamino)-2,4-dimethylpentan-2-ol has a molecular weight of 265.44 g/mol, XLogP of 3.20, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-adamantylamino)-2,4-dimethylpentan-2-ol is sourced from PubChem (CID 66179718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).