About 3-ethyl-N-(2-hydroxy-2,4-dimethylpentyl)-5-methyl-1,2-oxazole-4-carboxamide
3-ethyl-N-(2-hydroxy-2,4-dimethylpentyl)-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 66179726) has the molecular formula C14H24N2O3
and a molecular weight of 268.36 g/mol. Its IUPAC name is 3-ethyl-N-(2-hydroxy-2,4-dimethylpentyl)-5-methyl-1,2-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 3-ethyl-N-(2-hydroxy-2,4-dimethylpentyl)-5-methyl-1,2-oxazole-4-carboxamide |
| PubChem CID | 66179726 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 3-ethyl-N-(2-hydroxy-2,4-dimethylpentyl)-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | CCc1noc(C)c1C(=O)NCC(C)(O)CC(C)C |
| InChI | InChI=1S/C14H24N2O3/c1-6-11-12(10(4)19-16-11)13(17)15-8-14(5,18)7-9(2)3/h9,18H,6-8H2,1-5H3,(H,15,17) |
| InChIKey | YGEOWLAATRXDBH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-ethyl-N-(2-hydroxy-2,4-dimethylpentyl)-5-methyl-1,2-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-N-(2-hydroxy-2,4-dimethylpentyl)-5-methyl-1,2-oxazole-4-carboxamide?
The IUPAC name of 3-ethyl-N-(2-hydroxy-2,4-dimethylpentyl)-5-methyl-1,2-oxazole-4-carboxamide (CID 66179726) is 3-ethyl-N-(2-hydroxy-2,4-dimethylpentyl)-5-methyl-1,2-oxazole-4-carboxamide.
What is the SMILES notation for 3-ethyl-N-(2-hydroxy-2,4-dimethylpentyl)-5-methyl-1,2-oxazole-4-carboxamide?
The canonical SMILES for 3-ethyl-N-(2-hydroxy-2,4-dimethylpentyl)-5-methyl-1,2-oxazole-4-carboxamide is CCc1noc(C)c1C(=O)NCC(C)(O)CC(C)C.
What is the InChIKey of 3-ethyl-N-(2-hydroxy-2,4-dimethylpentyl)-5-methyl-1,2-oxazole-4-carboxamide?
The InChIKey is YGEOWLAATRXDBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2O3/c1-6-11-12(10(4)19-16-11)13(17)15-8-14(5,18)7-9(2)3/h9,18H,6-8H2,1-5H3,(H,15,17).
What are the key properties of 3-ethyl-N-(2-hydroxy-2,4-dimethylpentyl)-5-methyl-1,2-oxazole-4-carboxamide?
3-ethyl-N-(2-hydroxy-2,4-dimethylpentyl)-5-methyl-1,2-oxazole-4-carboxamide has a molecular weight of 268.36 g/mol, XLogP of 2.07, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-N-(2-hydroxy-2,4-dimethylpentyl)-5-methyl-1,2-oxazole-4-carboxamide is sourced from PubChem (CID 66179726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).