About N-(2-hydroxy-2,4-dimethylpentyl)-3-methoxypropane-1-sulfonamide
N-(2-hydroxy-2,4-dimethylpentyl)-3-methoxypropane-1-sulfonamide (PubChem CID 66179773) has the molecular formula C11H25NO4S
and a molecular weight of 267.39 g/mol. Its IUPAC name is N-(2-hydroxy-2,4-dimethylpentyl)-3-methoxypropane-1-sulfonamide.
Molecular Properties
| Compound Name | N-(2-hydroxy-2,4-dimethylpentyl)-3-methoxypropane-1-sulfonamide |
| PubChem CID | 66179773 |
| Molecular Formula | C11H25NO4S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | N-(2-hydroxy-2,4-dimethylpentyl)-3-methoxypropane-1-sulfonamide |
| SMILES | COCCCS(=O)(=O)NCC(C)(O)CC(C)C |
| InChI | InChI=1S/C11H25NO4S/c1-10(2)8-11(3,13)9-12-17(14,15)7-5-6-16-4/h10,12-13H,5-9H2,1-4H3 |
| InChIKey | SEPFQRBUDRWCNU-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(2-hydroxy-2,4-dimethylpentyl)-3-methoxypropane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxy-2,4-dimethylpentyl)-3-methoxypropane-1-sulfonamide?
The IUPAC name of N-(2-hydroxy-2,4-dimethylpentyl)-3-methoxypropane-1-sulfonamide (CID 66179773) is N-(2-hydroxy-2,4-dimethylpentyl)-3-methoxypropane-1-sulfonamide.
What is the SMILES notation for N-(2-hydroxy-2,4-dimethylpentyl)-3-methoxypropane-1-sulfonamide?
The canonical SMILES for N-(2-hydroxy-2,4-dimethylpentyl)-3-methoxypropane-1-sulfonamide is COCCCS(=O)(=O)NCC(C)(O)CC(C)C.
What is the InChIKey of N-(2-hydroxy-2,4-dimethylpentyl)-3-methoxypropane-1-sulfonamide?
The InChIKey is SEPFQRBUDRWCNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25NO4S/c1-10(2)8-11(3,13)9-12-17(14,15)7-5-6-16-4/h10,12-13H,5-9H2,1-4H3.
What are the key properties of N-(2-hydroxy-2,4-dimethylpentyl)-3-methoxypropane-1-sulfonamide?
N-(2-hydroxy-2,4-dimethylpentyl)-3-methoxypropane-1-sulfonamide has a molecular weight of 267.39 g/mol, XLogP of 0.74, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxy-2,4-dimethylpentyl)-3-methoxypropane-1-sulfonamide is sourced from PubChem (CID 66179773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).