C12H22N2O3 — CID 66179830
4,4-dimethoxy-2-methyl-2-(oxolan-2-ylmethylamino)butanenitrile (PubChem CID 66179830) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is 4,4-dimethoxy-2-methyl-2-(oxolan-2-ylmethylamino)butanenitrile.
| Compound Name | 4,4-dimethoxy-2-methyl-2-(oxolan-2-ylmethylamino)butanenitrile |
|---|---|
| PubChem CID | 66179830 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 4,4-dimethoxy-2-methyl-2-(oxolan-2-ylmethylamino)butanenitrile |
| SMILES | COC(CC(C)(C#N)NCC1CCCO1)OC |
| InChI | InChI=1S/C12H22N2O3/c1-12(9-13,7-11(15-2)16-3)14-8-10-5-4-6-17-10/h10-11,14H,4-8H2,1-3H3 |
| InChIKey | DPKCBXNOWLQGAK-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 63.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|