C11H26N2O2 — CID 66179836
2-N-butan-2-yl-3,3-dimethoxy-2-N,2-dimethylpropane-1,2-diamine (PubChem CID 66179836) has the molecular formula C11H26N2O2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 2-N-butan-2-yl-3,3-dimethoxy-2-N,2-dimethylpropane-1,2-diamine.
| Compound Name | 2-N-butan-2-yl-3,3-dimethoxy-2-N,2-dimethylpropane-1,2-diamine |
|---|---|
| PubChem CID | 66179836 |
| Molecular Formula | C11H26N2O2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | 2-N-butan-2-yl-3,3-dimethoxy-2-N,2-dimethylpropane-1,2-diamine |
| SMILES | CCC(C)N(C)C(C)(CN)C(OC)OC |
| InChI | InChI=1S/C11H26N2O2/c1-7-9(2)13(4)11(3,8-12)10(14-5)15-6/h9-10H,7-8,12H2,1-6H3 |
| InChIKey | HFYNCZIUOPDSQD-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|