C15H26N2O3 — CID 66179840
3,3-dimethoxy-2-N-[(2-methoxyphenyl)methyl]-2-N,2-dimethylpropane-1,2-diamine (PubChem CID 66179840) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is 3,3-dimethoxy-2-N-[(2-methoxyphenyl)methyl]-2-N,2-dimethylpropane-1,2-diamine.
| Compound Name | 3,3-dimethoxy-2-N-[(2-methoxyphenyl)methyl]-2-N,2-dimethylpropane-1,2-diamine |
|---|---|
| PubChem CID | 66179840 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 3,3-dimethoxy-2-N-[(2-methoxyphenyl)methyl]-2-N,2-dimethylpropane-1,2-diamine |
| SMILES | COc1ccccc1CN(C)C(C)(CN)C(OC)OC |
| InChI | InChI=1S/C15H26N2O3/c1-15(11-16,14(19-4)20-5)17(2)10-12-8-6-7-9-13(12)18-3/h6-9,14H,10-11,16H2,1-5H3 |
| InChIKey | CFLQCYIWJHFMAK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|