C11H21NO3S — CID 66179944
2-methyl-2-(2-methylpropyl)-3,4,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazine 6,6-dioxide (PubChem CID 66179944) has the molecular formula C11H21NO3S and a molecular weight of 247.36 g/mol. Its IUPAC name is 2-methyl-2-(2-methylpropyl)-3,4,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazine 6,6-dioxide.
| Compound Name | 2-methyl-2-(2-methylpropyl)-3,4,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazine 6,6-dioxide |
|---|---|
| PubChem CID | 66179944 |
| Molecular Formula | C11H21NO3S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 2-methyl-2-(2-methylpropyl)-3,4,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazine 6,6-dioxide |
| SMILES | CC(C)CC1(C)CNC2CS(=O)(=O)CC2O1 |
| InChI | InChI=1S/C11H21NO3S/c1-8(2)4-11(3)7-12-9-5-16(13,14)6-10(9)15-11/h8-10,12H,4-7H2,1-3H3 |
| InChIKey | BOHGRRKGAZWRFP-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |