C13H19BrN2O2 — CID 66180153
5-bromo-N-(2-hydroxy-2,4-dimethylpentyl)pyridine-3-carboxamide (PubChem CID 66180153) has the molecular formula C13H19BrN2O2 and a molecular weight of 315.21 g/mol. Its IUPAC name is 5-bromo-N-(2-hydroxy-2,4-dimethylpentyl)pyridine-3-carboxamide.
| Compound Name | 5-bromo-N-(2-hydroxy-2,4-dimethylpentyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66180153 |
| Molecular Formula | C13H19BrN2O2 |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 5-bromo-N-(2-hydroxy-2,4-dimethylpentyl)pyridine-3-carboxamide |
| SMILES | CC(C)CC(C)(O)CNC(=O)c1cncc(Br)c1 |
| InChI | InChI=1S/C13H19BrN2O2/c1-9(2)5-13(3,18)8-16-12(17)10-4-11(14)7-15-6-10/h4,6-7,9,18H,5,8H2,1-3H3,(H,16,17) |
| InChIKey | NRWIPAGERHNZDV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |