C13H26F3N3O2 — CID 66180210
4,4-dimethoxy-2-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-1-amine (PubChem CID 66180210) has the molecular formula C13H26F3N3O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 4,4-dimethoxy-2-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-1-amine.
| Compound Name | 4,4-dimethoxy-2-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-1-amine |
|---|---|
| PubChem CID | 66180210 |
| Molecular Formula | C13H26F3N3O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 4,4-dimethoxy-2-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-1-amine |
| SMILES | COC(CC(C)(CN)N1CCN(CC(F)(F)F)CC1)OC |
| InChI | InChI=1S/C13H26F3N3O2/c1-12(9-17,8-11(20-2)21-3)19-6-4-18(5-7-19)10-13(14,15)16/h11H,4-10,17H2,1-3H3 |
| InChIKey | BDDRJVKGGBSRIP-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 50.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|