C14H32N2O3 — CID 66180809
2-N-butan-2-yl-4,4-dimethoxy-2-N-(2-methoxyethyl)-2-methylbutane-1,2-diamine (PubChem CID 66180809) has the molecular formula C14H32N2O3 and a molecular weight of 276.42 g/mol. Its IUPAC name is 2-N-butan-2-yl-4,4-dimethoxy-2-N-(2-methoxyethyl)-2-methylbutane-1,2-diamine.
| Compound Name | 2-N-butan-2-yl-4,4-dimethoxy-2-N-(2-methoxyethyl)-2-methylbutane-1,2-diamine |
|---|---|
| PubChem CID | 66180809 |
| Molecular Formula | C14H32N2O3 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.24 |
| IUPAC Name | 2-N-butan-2-yl-4,4-dimethoxy-2-N-(2-methoxyethyl)-2-methylbutane-1,2-diamine |
| SMILES | CCC(C)N(CCOC)C(C)(CN)CC(OC)OC |
| InChI | InChI=1S/C14H32N2O3/c1-7-12(2)16(8-9-17-4)14(3,11-15)10-13(18-5)19-6/h12-13H,7-11,15H2,1-6H3 |
| InChIKey | NVECGWDLKZVKBI-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|