C13H17Cl2N3O — CID 66181735
2-[azetidin-3-yl(ethyl)amino]-N-(2,3-dichlorophenyl)acetamide (PubChem CID 66181735) has the molecular formula C13H17Cl2N3O and a molecular weight of 302.20 g/mol. Its IUPAC name is 2-[azetidin-3-yl(ethyl)amino]-N-(2,3-dichlorophenyl)acetamide.
| Compound Name | 2-[azetidin-3-yl(ethyl)amino]-N-(2,3-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 66181735 |
| Molecular Formula | C13H17Cl2N3O |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 2-[azetidin-3-yl(ethyl)amino]-N-(2,3-dichlorophenyl)acetamide |
| SMILES | CCN(CC(=O)Nc1cccc(Cl)c1Cl)C1CNC1 |
| InChI | InChI=1S/C13H17Cl2N3O/c1-2-18(9-6-16-7-9)8-12(19)17-11-5-3-4-10(14)13(11)15/h3-5,9,16H,2,6-8H2,1H3,(H,17,19) |
| InChIKey | QOAJQCNNDLOFET-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |