About N-(azetidin-3-yl)-N,2-dimethylpyrimidin-4-amine
N-(azetidin-3-yl)-N,2-dimethylpyrimidin-4-amine (PubChem CID 66182049) has the molecular formula C9H14N4
and a molecular weight of 178.24 g/mol. Its IUPAC name is N-(azetidin-3-yl)-N,2-dimethylpyrimidin-4-amine.
Molecular Properties
| Compound Name | N-(azetidin-3-yl)-N,2-dimethylpyrimidin-4-amine |
| PubChem CID | 66182049 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | N-(azetidin-3-yl)-N,2-dimethylpyrimidin-4-amine |
| SMILES | Cc1nccc(N(C)C2CNC2)n1 |
| InChI | InChI=1S/C9H14N4/c1-7-11-4-3-9(12-7)13(2)8-5-10-6-8/h3-4,8,10H,5-6H2,1-2H3 |
| InChIKey | MAOFSXPBMFQYDS-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(azetidin-3-yl)-N,2-dimethylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(azetidin-3-yl)-N,2-dimethylpyrimidin-4-amine?
The IUPAC name of N-(azetidin-3-yl)-N,2-dimethylpyrimidin-4-amine (CID 66182049) is N-(azetidin-3-yl)-N,2-dimethylpyrimidin-4-amine.
What is the SMILES notation for N-(azetidin-3-yl)-N,2-dimethylpyrimidin-4-amine?
The canonical SMILES for N-(azetidin-3-yl)-N,2-dimethylpyrimidin-4-amine is Cc1nccc(N(C)C2CNC2)n1.
What is the InChIKey of N-(azetidin-3-yl)-N,2-dimethylpyrimidin-4-amine?
The InChIKey is MAOFSXPBMFQYDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4/c1-7-11-4-3-9(12-7)13(2)8-5-10-6-8/h3-4,8,10H,5-6H2,1-2H3.
What are the key properties of N-(azetidin-3-yl)-N,2-dimethylpyrimidin-4-amine?
N-(azetidin-3-yl)-N,2-dimethylpyrimidin-4-amine has a molecular weight of 178.24 g/mol, XLogP of 0.19, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(azetidin-3-yl)-N,2-dimethylpyrimidin-4-amine is sourced from PubChem (CID 66182049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).