About N-(azetidin-3-yl)-N,6-dimethyl-2-propan-2-ylpyrimidin-4-amine
N-(azetidin-3-yl)-N,6-dimethyl-2-propan-2-ylpyrimidin-4-amine (PubChem CID 66183116) has the molecular formula C12H20N4
and a molecular weight of 220.32 g/mol. Its IUPAC name is N-(azetidin-3-yl)-N,6-dimethyl-2-propan-2-ylpyrimidin-4-amine.
Molecular Properties
| Compound Name | N-(azetidin-3-yl)-N,6-dimethyl-2-propan-2-ylpyrimidin-4-amine |
| PubChem CID | 66183116 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | N-(azetidin-3-yl)-N,6-dimethyl-2-propan-2-ylpyrimidin-4-amine |
| SMILES | Cc1cc(N(C)C2CNC2)nc(C(C)C)n1 |
| InChI | InChI=1S/C12H20N4/c1-8(2)12-14-9(3)5-11(15-12)16(4)10-6-13-7-10/h5,8,10,13H,6-7H2,1-4H3 |
| InChIKey | YWCUXAYZRHYPBM-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(azetidin-3-yl)-N,6-dimethyl-2-propan-2-ylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(azetidin-3-yl)-N,6-dimethyl-2-propan-2-ylpyrimidin-4-amine?
The IUPAC name of N-(azetidin-3-yl)-N,6-dimethyl-2-propan-2-ylpyrimidin-4-amine (CID 66183116) is N-(azetidin-3-yl)-N,6-dimethyl-2-propan-2-ylpyrimidin-4-amine.
What is the SMILES notation for N-(azetidin-3-yl)-N,6-dimethyl-2-propan-2-ylpyrimidin-4-amine?
The canonical SMILES for N-(azetidin-3-yl)-N,6-dimethyl-2-propan-2-ylpyrimidin-4-amine is Cc1cc(N(C)C2CNC2)nc(C(C)C)n1.
What is the InChIKey of N-(azetidin-3-yl)-N,6-dimethyl-2-propan-2-ylpyrimidin-4-amine?
The InChIKey is YWCUXAYZRHYPBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4/c1-8(2)12-14-9(3)5-11(15-12)16(4)10-6-13-7-10/h5,8,10,13H,6-7H2,1-4H3.
What are the key properties of N-(azetidin-3-yl)-N,6-dimethyl-2-propan-2-ylpyrimidin-4-amine?
N-(azetidin-3-yl)-N,6-dimethyl-2-propan-2-ylpyrimidin-4-amine has a molecular weight of 220.32 g/mol, XLogP of 1.32, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(azetidin-3-yl)-N,6-dimethyl-2-propan-2-ylpyrimidin-4-amine is sourced from PubChem (CID 66183116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).