About 1-(2,3-dihydroxy-2-methylpropyl)-3-methylpyrrole-2,5-dione
1-(2,3-dihydroxy-2-methylpropyl)-3-methylpyrrole-2,5-dione (PubChem CID 66185307) has the molecular formula C9H13NO4
and a molecular weight of 199.21 g/mol. Its IUPAC name is 1-(2,3-dihydroxy-2-methylpropyl)-3-methylpyrrole-2,5-dione.
Molecular Properties
| Compound Name | 1-(2,3-dihydroxy-2-methylpropyl)-3-methylpyrrole-2,5-dione |
| PubChem CID | 66185307 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 1-(2,3-dihydroxy-2-methylpropyl)-3-methylpyrrole-2,5-dione |
| SMILES | CC1=CC(=O)N(CC(C)(O)CO)C1=O |
| InChI | InChI=1S/C9H13NO4/c1-6-3-7(12)10(8(6)13)4-9(2,14)5-11/h3,11,14H,4-5H2,1-2H3 |
| InChIKey | YEXJXCAKPIRVFC-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,3-dihydroxy-2-methylpropyl)-3-methylpyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dihydroxy-2-methylpropyl)-3-methylpyrrole-2,5-dione?
The IUPAC name of 1-(2,3-dihydroxy-2-methylpropyl)-3-methylpyrrole-2,5-dione (CID 66185307) is 1-(2,3-dihydroxy-2-methylpropyl)-3-methylpyrrole-2,5-dione.
What is the SMILES notation for 1-(2,3-dihydroxy-2-methylpropyl)-3-methylpyrrole-2,5-dione?
The canonical SMILES for 1-(2,3-dihydroxy-2-methylpropyl)-3-methylpyrrole-2,5-dione is CC1=CC(=O)N(CC(C)(O)CO)C1=O.
What is the InChIKey of 1-(2,3-dihydroxy-2-methylpropyl)-3-methylpyrrole-2,5-dione?
The InChIKey is YEXJXCAKPIRVFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO4/c1-6-3-7(12)10(8(6)13)4-9(2,14)5-11/h3,11,14H,4-5H2,1-2H3.
What are the key properties of 1-(2,3-dihydroxy-2-methylpropyl)-3-methylpyrrole-2,5-dione?
1-(2,3-dihydroxy-2-methylpropyl)-3-methylpyrrole-2,5-dione has a molecular weight of 199.21 g/mol, XLogP of -0.96, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dihydroxy-2-methylpropyl)-3-methylpyrrole-2,5-dione is sourced from PubChem (CID 66185307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).