C13H11N3S6 — CID 6618631
1-phenyl-3-[(2-sulfanylidene-[1,3]dithiolo[4,5-b][1,4]dithiepin-6-ylidene)amino]thiourea (PubChem CID 6618631) has the molecular formula C13H11N3S6 and a molecular weight of 401.65 g/mol. Its IUPAC name is 1-phenyl-3-[(2-sulfanylidene-[1,3]dithiolo[4,5-b][1,4]dithiepin-6-ylidene)amino]thiourea.
| Compound Name | 1-phenyl-3-[(2-sulfanylidene-[1,3]dithiolo[4,5-b][1,4]dithiepin-6-ylidene)amino]thiourea |
|---|---|
| PubChem CID | 6618631 |
| Molecular Formula | C13H11N3S6 |
| Molecular Weight | 401.65 g/mol |
| Exact Mass | 400.93 |
| IUPAC Name | 1-phenyl-3-[(2-sulfanylidene-[1,3]dithiolo[4,5-b][1,4]dithiepin-6-ylidene)amino]thiourea |
| SMILES | S=C(NN=C1CSc2sc(=S)sc2SC1)Nc1ccccc1 |
| InChI | InChI=1S/C13H11N3S6/c17-12(14-8-4-2-1-3-5-8)16-15-9-6-19-10-11(20-7-9)22-13(18)21-10/h1-5H,6-7H2,(H2,14,16,17) |
| InChIKey | ZVGYLFJGUNVASP-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.65 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|