About N-(azetidin-3-yl)-3,5,5-trimethylhexanamide
N-(azetidin-3-yl)-3,5,5-trimethylhexanamide (PubChem CID 66186755) has the molecular formula C12H24N2O
and a molecular weight of 212.34 g/mol. Its IUPAC name is N-(azetidin-3-yl)-3,5,5-trimethylhexanamide.
Molecular Properties
| Compound Name | N-(azetidin-3-yl)-3,5,5-trimethylhexanamide |
| PubChem CID | 66186755 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | N-(azetidin-3-yl)-3,5,5-trimethylhexanamide |
| SMILES | CC(CC(=O)NC1CNC1)CC(C)(C)C |
| InChI | InChI=1S/C12H24N2O/c1-9(6-12(2,3)4)5-11(15)14-10-7-13-8-10/h9-10,13H,5-8H2,1-4H3,(H,14,15) |
| InChIKey | LNSOHWIWIFOLDY-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(azetidin-3-yl)-3,5,5-trimethylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(azetidin-3-yl)-3,5,5-trimethylhexanamide?
The IUPAC name of N-(azetidin-3-yl)-3,5,5-trimethylhexanamide (CID 66186755) is N-(azetidin-3-yl)-3,5,5-trimethylhexanamide.
What is the SMILES notation for N-(azetidin-3-yl)-3,5,5-trimethylhexanamide?
The canonical SMILES for N-(azetidin-3-yl)-3,5,5-trimethylhexanamide is CC(CC(=O)NC1CNC1)CC(C)(C)C.
What is the InChIKey of N-(azetidin-3-yl)-3,5,5-trimethylhexanamide?
The InChIKey is LNSOHWIWIFOLDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O/c1-9(6-12(2,3)4)5-11(15)14-10-7-13-8-10/h9-10,13H,5-8H2,1-4H3,(H,14,15).
What are the key properties of N-(azetidin-3-yl)-3,5,5-trimethylhexanamide?
N-(azetidin-3-yl)-3,5,5-trimethylhexanamide has a molecular weight of 212.34 g/mol, XLogP of 1.54, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(azetidin-3-yl)-3,5,5-trimethylhexanamide is sourced from PubChem (CID 66186755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).