About N-(azetidin-3-yl)-2,2-dimethylpropane-1-sulfonamide
N-(azetidin-3-yl)-2,2-dimethylpropane-1-sulfonamide (PubChem CID 66186773) has the molecular formula C8H18N2O2S
and a molecular weight of 206.31 g/mol. Its IUPAC name is N-(azetidin-3-yl)-2,2-dimethylpropane-1-sulfonamide.
Molecular Properties
| Compound Name | N-(azetidin-3-yl)-2,2-dimethylpropane-1-sulfonamide |
| PubChem CID | 66186773 |
| Molecular Formula | C8H18N2O2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | N-(azetidin-3-yl)-2,2-dimethylpropane-1-sulfonamide |
| SMILES | CC(C)(C)CS(=O)(=O)NC1CNC1 |
| InChI | InChI=1S/C8H18N2O2S/c1-8(2,3)6-13(11,12)10-7-4-9-5-7/h7,9-10H,4-6H2,1-3H3 |
| InChIKey | KDCMXSJXDWTQRO-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(azetidin-3-yl)-2,2-dimethylpropane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(azetidin-3-yl)-2,2-dimethylpropane-1-sulfonamide?
The IUPAC name of N-(azetidin-3-yl)-2,2-dimethylpropane-1-sulfonamide (CID 66186773) is N-(azetidin-3-yl)-2,2-dimethylpropane-1-sulfonamide.
What is the SMILES notation for N-(azetidin-3-yl)-2,2-dimethylpropane-1-sulfonamide?
The canonical SMILES for N-(azetidin-3-yl)-2,2-dimethylpropane-1-sulfonamide is CC(C)(C)CS(=O)(=O)NC1CNC1.
What is the InChIKey of N-(azetidin-3-yl)-2,2-dimethylpropane-1-sulfonamide?
The InChIKey is KDCMXSJXDWTQRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O2S/c1-8(2,3)6-13(11,12)10-7-4-9-5-7/h7,9-10H,4-6H2,1-3H3.
What are the key properties of N-(azetidin-3-yl)-2,2-dimethylpropane-1-sulfonamide?
N-(azetidin-3-yl)-2,2-dimethylpropane-1-sulfonamide has a molecular weight of 206.31 g/mol, XLogP of -0.08, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(azetidin-3-yl)-2,2-dimethylpropane-1-sulfonamide is sourced from PubChem (CID 66186773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).