C23H23N3O — CID 6618695
1,3,3,4,5-pentamethylspiro[indole-2,3'-pyrido[3,2-f][1,4]benzoxazine] (PubChem CID 6618695) has the molecular formula C23H23N3O and a molecular weight of 357.46 g/mol. Its IUPAC name is 1,3,3,4,5-pentamethylspiro[indole-2,3'-pyrido[3,2-f][1,4]benzoxazine].
| Compound Name | 1,3,3,4,5-pentamethylspiro[indole-2,3'-pyrido[3,2-f][1,4]benzoxazine] |
|---|---|
| PubChem CID | 6618695 |
| Molecular Formula | C23H23N3O |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 1,3,3,4,5-pentamethylspiro[indole-2,3'-pyrido[3,2-f][1,4]benzoxazine] |
| SMILES | Cc1ccc2c(c1C)C(C)(C)C1(C=Nc3c(ccc4ncccc34)O1)N2C |
| InChI | InChI=1S/C23H23N3O/c1-14-8-10-18-20(15(14)2)22(3,4)23(26(18)5)13-25-21-16-7-6-12-24-17(16)9-11-19(21)27-23/h6-13H,1-5H3 |
| InChIKey | ZDHIKSOKXUQHKB-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |