About N-(azetidin-3-yl)-1,5-dimethylpyrazole-4-carboxamide
N-(azetidin-3-yl)-1,5-dimethylpyrazole-4-carboxamide (PubChem CID 66187230) has the molecular formula C9H14N4O
and a molecular weight of 194.24 g/mol. Its IUPAC name is N-(azetidin-3-yl)-1,5-dimethylpyrazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(azetidin-3-yl)-1,5-dimethylpyrazole-4-carboxamide |
| PubChem CID | 66187230 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | N-(azetidin-3-yl)-1,5-dimethylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NC2CNC2)cnn1C |
| InChI | InChI=1S/C9H14N4O/c1-6-8(5-11-13(6)2)9(14)12-7-3-10-4-7/h5,7,10H,3-4H2,1-2H3,(H,12,14) |
| InChIKey | VFLJLQSIEMBJIE-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(azetidin-3-yl)-1,5-dimethylpyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(azetidin-3-yl)-1,5-dimethylpyrazole-4-carboxamide?
The IUPAC name of N-(azetidin-3-yl)-1,5-dimethylpyrazole-4-carboxamide (CID 66187230) is N-(azetidin-3-yl)-1,5-dimethylpyrazole-4-carboxamide.
What is the SMILES notation for N-(azetidin-3-yl)-1,5-dimethylpyrazole-4-carboxamide?
The canonical SMILES for N-(azetidin-3-yl)-1,5-dimethylpyrazole-4-carboxamide is Cc1c(C(=O)NC2CNC2)cnn1C.
What is the InChIKey of N-(azetidin-3-yl)-1,5-dimethylpyrazole-4-carboxamide?
The InChIKey is VFLJLQSIEMBJIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4O/c1-6-8(5-11-13(6)2)9(14)12-7-3-10-4-7/h5,7,10H,3-4H2,1-2H3,(H,12,14).
What are the key properties of N-(azetidin-3-yl)-1,5-dimethylpyrazole-4-carboxamide?
N-(azetidin-3-yl)-1,5-dimethylpyrazole-4-carboxamide has a molecular weight of 194.24 g/mol, XLogP of -0.57, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(azetidin-3-yl)-1,5-dimethylpyrazole-4-carboxamide is sourced from PubChem (CID 66187230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).