C16H19N3O4 — CID 6618836
5-amino-3-(3,4,5-triethoxyphenyl)-1,2-oxazole-4-carbonitrile (PubChem CID 6618836) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is 5-amino-3-(3,4,5-triethoxyphenyl)-1,2-oxazole-4-carbonitrile.
| Compound Name | 5-amino-3-(3,4,5-triethoxyphenyl)-1,2-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 6618836 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 5-amino-3-(3,4,5-triethoxyphenyl)-1,2-oxazole-4-carbonitrile |
| SMILES | CCOc1cc(-c2noc(N)c2C#N)cc(OCC)c1OCC |
| InChI | InChI=1S/C16H19N3O4/c1-4-20-12-7-10(14-11(9-17)16(18)23-19-14)8-13(21-5-2)15(12)22-6-3/h7-8H,4-6,18H2,1-3H3 |
| InChIKey | OLALEGDVRAAJRH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |